C17H16O2S — CID 12815430
2-(methylsulfanylmethyl)-1,3-diphenylpropane-1,3-dione (PubChem CID 12815430) has the molecular formula C17H16O2S and a molecular weight of 284.38 g/mol. Its IUPAC name is 2-(methylsulfanylmethyl)-1,3-diphenylpropane-1,3-dione.
| Compound Name | 2-(methylsulfanylmethyl)-1,3-diphenylpropane-1,3-dione |
|---|---|
| PubChem CID | 12815430 |
| Molecular Formula | C17H16O2S |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | 2-(methylsulfanylmethyl)-1,3-diphenylpropane-1,3-dione |
| SMILES | CSCC(C(=O)c1ccccc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C17H16O2S/c1-20-12-15(16(18)13-8-4-2-5-9-13)17(19)14-10-6-3-7-11-14/h2-11,15H,12H2,1H3 |
| InChIKey | FWCLDVJEBVBDSH-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|