C40H34Cl2O10 — CID 158534697
2,5-dibenzoylhexanedioic acid;2,5-dibenzoylhexanedioyl dichloride (PubChem CID 158534697) has the molecular formula C40H34Cl2O10 and a molecular weight of 745.61 g/mol. Its IUPAC name is 2,5-dibenzoylhexanedioic acid;2,5-dibenzoylhexanedioyl dichloride.
| Compound Name | 2,5-dibenzoylhexanedioic acid;2,5-dibenzoylhexanedioyl dichloride |
|---|---|
| PubChem CID | 158534697 |
| Molecular Formula | C40H34Cl2O10 |
| Molecular Weight | 745.61 g/mol |
| Exact Mass | 744.15 |
| IUPAC Name | 2,5-dibenzoylhexanedioic acid;2,5-dibenzoylhexanedioyl dichloride |
| SMILES | O=C(Cl)C(CCC(C(=O)Cl)C(=O)c1ccccc1)C(=O)c1ccccc1.O=C(O)C(CCC(C(=O)O)C(=O)c1ccccc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C20H16Cl2O4.C20H18O6/c21-19(25)15(17(23)13-7-3-1-4-8-13)11-12-16(20(22)26)18(24)14-9-5-2-6-10-14;21-17(13-7-3-1-4-8-13)15(19(23)24)11-12-16(20(25)26)18(22)14-9-5-2-6-10-14/h1-10,15-16H,11-12H2;1-10,15-16H,11-12H2,(H,23,24)(H,25,26) |
| InChIKey | HNUKDLMXEOEHLN-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 177.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.61 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|