About CID 150550422
CID 150550422 (PubChem CID 150550422) has the molecular formula C16H13B3O2
and a molecular weight of 269.71 g/mol.
Molecular Properties
| Compound Name | CID 150550422 |
| PubChem CID | 150550422 |
| Molecular Formula | C16H13B3O2 |
| Molecular Weight | 269.71 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | — |
| SMILES | [B][B][B]CC(C(=O)c1ccccc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C16H13B3O2/c17-19-18-11-14(15(20)12-7-3-1-4-8-12)16(21)13-9-5-2-6-10-13/h1-10,14H,11H2 |
| InChIKey | OEYBAHUABPXSGL-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.71 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 150550422 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 150550422?
The IUPAC name of CID 150550422 (CID 150550422) is not available.
What is the SMILES notation for CID 150550422?
The canonical SMILES for CID 150550422 is [B][B][B]CC(C(=O)c1ccccc1)C(=O)c1ccccc1.
What is the InChIKey of CID 150550422?
The InChIKey is OEYBAHUABPXSGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13B3O2/c17-19-18-11-14(15(20)12-7-3-1-4-8-12)16(21)13-9-5-2-6-10-13/h1-10,14H,11H2.
What are the key properties of CID 150550422?
CID 150550422 has a molecular weight of 269.71 g/mol, XLogP of 2.19, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 150550422 is sourced from PubChem (CID 150550422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).