sodium 2-benzoylbutanoate

C11H11NaO3 — CID 67926417

IUPACsodium 2-benzoylbutanoate
SMILESCCC(C(=O)[O-])C(=O)c1ccccc1.[Na+]
InChIInChI=1S/C11H12O3.Na/c1-2-9(11(13)14)10(12)8-6-4-3-5-7-8;/h3-7,9H,2H2,1H3,(H,13,14);/q;+1/p-1
InChIKeyMSOVEWBWGNEWAC-UHFFFAOYSA-M
MW214.20 g/mol
LogP-2.35
Rot. Bonds4

About sodium 2-benzoylbutanoate

sodium 2-benzoylbutanoate (PubChem CID 67926417) has the molecular formula C11H11NaO3 and a molecular weight of 214.20 g/mol. Its IUPAC name is sodium 2-benzoylbutanoate.

Molecular Properties

Compound Namesodium 2-benzoylbutanoate
PubChem CID67926417
Molecular FormulaC11H11NaO3
Molecular Weight214.20 g/mol
Exact Mass214.06
IUPAC Namesodium 2-benzoylbutanoate
SMILESCCC(C(=O)[O-])C(=O)c1ccccc1.[Na+]
InChIInChI=1S/C11H12O3.Na/c1-2-9(11(13)14)10(12)8-6-4-3-5-7-8;/h3-7,9H,2H2,1H3,(H,13,14);/q;+1/p-1
InChIKeyMSOVEWBWGNEWAC-UHFFFAOYSA-M
XLogP-2.35
TPSA57.20 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500214.20
LogP ≤ 5-2.35
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze sodium 2-benzoylbutanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium 2-benzoylbutanoate?
The IUPAC name of sodium 2-benzoylbutanoate (CID 67926417) is sodium 2-benzoylbutanoate.
What is the SMILES notation for sodium 2-benzoylbutanoate?
The canonical SMILES for sodium 2-benzoylbutanoate is CCC(C(=O)[O-])C(=O)c1ccccc1.[Na+].
What is the InChIKey of sodium 2-benzoylbutanoate?
The InChIKey is MSOVEWBWGNEWAC-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H12O3.Na/c1-2-9(11(13)14)10(12)8-6-4-3-5-7-8;/h3-7,9H,2H2,1H3,(H,13,14);/q;+1/p-1.
What are the key properties of sodium 2-benzoylbutanoate?
sodium 2-benzoylbutanoate has a molecular weight of 214.20 g/mol, XLogP of -2.35, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-benzoylbutanoate is sourced from PubChem (CID 67926417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).