C12H20O4 — CID 10421304
6-[(2S)-2-hydroxyhexyl]-2,2-dimethyl-1,3-dioxin-4-one (PubChem CID 10421304) has the molecular formula C12H20O4 and a molecular weight of 228.29 g/mol. Its IUPAC name is 6-[(2S)-2-hydroxyhexyl]-2,2-dimethyl-1,3-dioxin-4-one.
| Compound Name | 6-[(2S)-2-hydroxyhexyl]-2,2-dimethyl-1,3-dioxin-4-one |
|---|---|
| PubChem CID | 10421304 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 6-[(2S)-2-hydroxyhexyl]-2,2-dimethyl-1,3-dioxin-4-one |
| SMILES | CCCC[C@H](O)CC1=CC(=O)OC(C)(C)O1 |
| InChI | InChI=1S/C12H20O4/c1-4-5-6-9(13)7-10-8-11(14)16-12(2,3)15-10/h8-9,13H,4-7H2,1-3H3/t9-/m0/s1 |
| InChIKey | BWLXPYLDFSTHQO-VIFPVBQESA-N |
| XLogP | 2.12 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |