About [3-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-2-oxopropyl] acetate
[3-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-2-oxopropyl] acetate (PubChem CID 22050786) has the molecular formula C11H14O6
and a molecular weight of 242.23 g/mol. Its IUPAC name is [3-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-2-oxopropyl] acetate.
Analyze [3-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-2-oxopropyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-2-oxopropyl] acetate?
The IUPAC name of [3-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-2-oxopropyl] acetate (CID 22050786) is [3-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-2-oxopropyl] acetate.
What is the SMILES notation for [3-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-2-oxopropyl] acetate?
The canonical SMILES for [3-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-2-oxopropyl] acetate is CC(=O)OCC(=O)CC1=CC(=O)OC(C)(C)O1.
What is the InChIKey of [3-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-2-oxopropyl] acetate?
The InChIKey is RKLSSTBXGFAQGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O6/c1-7(12)15-6-8(13)4-9-5-10(14)17-11(2,3)16-9/h5H,4,6H2,1-3H3.
What are the key properties of [3-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-2-oxopropyl] acetate?
[3-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-2-oxopropyl] acetate has a molecular weight of 242.23 g/mol, XLogP of 0.70, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-2-oxopropyl] acetate is sourced from PubChem (CID 22050786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).