C24H32O9 — CID 56958793
[(2E)-3,7-dimethylocta-2,6-dienyl] 2-(2-acetyloxyacetyl)-4-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-3-oxobutanoate (PubChem CID 56958793) has the molecular formula C24H32O9 and a molecular weight of 464.51 g/mol. Its IUPAC name is [(2E)-3,7-dimethylocta-2,6-dienyl] 2-(2-acetyloxyacetyl)-4-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-3-oxobutanoate.
| Compound Name | [(2E)-3,7-dimethylocta-2,6-dienyl] 2-(2-acetyloxyacetyl)-4-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-3-oxobutanoate |
|---|---|
| PubChem CID | 56958793 |
| Molecular Formula | C24H32O9 |
| Molecular Weight | 464.51 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | [(2E)-3,7-dimethylocta-2,6-dienyl] 2-(2-acetyloxyacetyl)-4-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)-3-oxobutanoate |
| SMILES | CC(=O)OCC(=O)C(C(=O)CC1=CC(=O)OC(C)(C)O1)C(=O)OC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C24H32O9/c1-15(2)8-7-9-16(3)10-11-30-23(29)22(20(27)14-31-17(4)25)19(26)12-18-13-21(28)33-24(5,6)32-18/h8,10,13,22H,7,9,11-12,14H2,1-6H3/b16-10+ |
| InChIKey | FKJSVTUFXMGBSQ-MHWRWJLKSA-N |
| XLogP | 3.12 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.51 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|