C18H22O4 — CID 71372413
3,7-dimethylocta-2,6-dienyl 1,3-benzodioxole-5-carboxylate (PubChem CID 71372413) has the molecular formula C18H22O4 and a molecular weight of 302.37 g/mol. Its IUPAC name is 3,7-dimethylocta-2,6-dienyl 1,3-benzodioxole-5-carboxylate.
| Compound Name | 3,7-dimethylocta-2,6-dienyl 1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 71372413 |
| Molecular Formula | C18H22O4 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 3,7-dimethylocta-2,6-dienyl 1,3-benzodioxole-5-carboxylate |
| SMILES | CC(C)=CCCC(C)=CCOC(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H22O4/c1-13(2)5-4-6-14(3)9-10-20-18(19)15-7-8-16-17(11-15)22-12-21-16/h5,7-9,11H,4,6,10,12H2,1-3H3 |
| InChIKey | DVSGBDHJJNZYLI-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|