3,7-dimethylocta-2,6-dienyl 1,3-benzodioxole-5-carboxylate

C18H22O4 — CID 71372413

IUPAC3,7-dimethylocta-2,6-dienyl 1,3-benzodioxole-5-carboxylate
SMILESCC(C)=CCCC(C)=CCOC(=O)c1ccc2c(c1)OCO2
InChIInChI=1S/C18H22O4/c1-13(2)5-4-6-14(3)9-10-20-18(19)15-7-8-16-17(11-15)22-12-21-16/h5,7-9,11H,4,6,10,12H2,1-3H3
InChIKeyDVSGBDHJJNZYLI-UHFFFAOYSA-N
MW302.37 g/mol
LogP4.26
Rot. Bonds6

About 3,7-dimethylocta-2,6-dienyl 1,3-benzodioxole-5-carboxylate

3,7-dimethylocta-2,6-dienyl 1,3-benzodioxole-5-carboxylate (PubChem CID 71372413) has the molecular formula C18H22O4 and a molecular weight of 302.37 g/mol. Its IUPAC name is 3,7-dimethylocta-2,6-dienyl 1,3-benzodioxole-5-carboxylate.

Molecular Properties

Compound Name3,7-dimethylocta-2,6-dienyl 1,3-benzodioxole-5-carboxylate
PubChem CID71372413
Molecular FormulaC18H22O4
Molecular Weight302.37 g/mol
Exact Mass302.15
IUPAC Name3,7-dimethylocta-2,6-dienyl 1,3-benzodioxole-5-carboxylate
SMILESCC(C)=CCCC(C)=CCOC(=O)c1ccc2c(c1)OCO2
InChIInChI=1S/C18H22O4/c1-13(2)5-4-6-14(3)9-10-20-18(19)15-7-8-16-17(11-15)22-12-21-16/h5,7-9,11H,4,6,10,12H2,1-3H3
InChIKeyDVSGBDHJJNZYLI-UHFFFAOYSA-N
XLogP4.26
TPSA44.76 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500302.37
LogP ≤ 54.26
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 3,7-dimethylocta-2,6-dienyl 1,3-benzodioxole-5-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,7-dimethylocta-2,6-dienyl 1,3-benzodioxole-5-carboxylate?
The IUPAC name of 3,7-dimethylocta-2,6-dienyl 1,3-benzodioxole-5-carboxylate (CID 71372413) is 3,7-dimethylocta-2,6-dienyl 1,3-benzodioxole-5-carboxylate.
What is the SMILES notation for 3,7-dimethylocta-2,6-dienyl 1,3-benzodioxole-5-carboxylate?
The canonical SMILES for 3,7-dimethylocta-2,6-dienyl 1,3-benzodioxole-5-carboxylate is CC(C)=CCCC(C)=CCOC(=O)c1ccc2c(c1)OCO2.
What is the InChIKey of 3,7-dimethylocta-2,6-dienyl 1,3-benzodioxole-5-carboxylate?
The InChIKey is DVSGBDHJJNZYLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22O4/c1-13(2)5-4-6-14(3)9-10-20-18(19)15-7-8-16-17(11-15)22-12-21-16/h5,7-9,11H,4,6,10,12H2,1-3H3.
What are the key properties of 3,7-dimethylocta-2,6-dienyl 1,3-benzodioxole-5-carboxylate?
3,7-dimethylocta-2,6-dienyl 1,3-benzodioxole-5-carboxylate has a molecular weight of 302.37 g/mol, XLogP of 4.26, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-dimethylocta-2,6-dienyl 1,3-benzodioxole-5-carboxylate is sourced from PubChem (CID 71372413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).