[(E)-3-phenylprop-2-enyl] 1,3-benzodioxole-5-carboxylate

C17H14O4 — CID 8012668

IUPAC[(E)-3-phenylprop-2-enyl] 1,3-benzodioxole-5-carboxylate
SMILESO=C(OC/C=C/c1ccccc1)c1ccc2c(c1)OCO2
InChIInChI=1S/C17H14O4/c18-17(14-8-9-15-16(11-14)21-12-20-15)19-10-4-7-13-5-2-1-3-6-13/h1-9,11H,10,12H2/b7-4+
InChIKeyUIUAGJIJOQOQKE-QPJJXVBHSA-N
MW282.29 g/mol
LogP3.29
Rot. Bonds4

About [(E)-3-phenylprop-2-enyl] 1,3-benzodioxole-5-carboxylate

[(E)-3-phenylprop-2-enyl] 1,3-benzodioxole-5-carboxylate (PubChem CID 8012668) has the molecular formula C17H14O4 and a molecular weight of 282.29 g/mol. Its IUPAC name is [(E)-3-phenylprop-2-enyl] 1,3-benzodioxole-5-carboxylate.

Molecular Properties

Compound Name[(E)-3-phenylprop-2-enyl] 1,3-benzodioxole-5-carboxylate
PubChem CID8012668
Molecular FormulaC17H14O4
Molecular Weight282.29 g/mol
Exact Mass282.09
IUPAC Name[(E)-3-phenylprop-2-enyl] 1,3-benzodioxole-5-carboxylate
SMILESO=C(OC/C=C/c1ccccc1)c1ccc2c(c1)OCO2
InChIInChI=1S/C17H14O4/c18-17(14-8-9-15-16(11-14)21-12-20-15)19-10-4-7-13-5-2-1-3-6-13/h1-9,11H,10,12H2/b7-4+
InChIKeyUIUAGJIJOQOQKE-QPJJXVBHSA-N
XLogP3.29
TPSA44.76 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500282.29
LogP ≤ 53.29
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze [(E)-3-phenylprop-2-enyl] 1,3-benzodioxole-5-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [(E)-3-phenylprop-2-enyl] 1,3-benzodioxole-5-carboxylate?
The IUPAC name of [(E)-3-phenylprop-2-enyl] 1,3-benzodioxole-5-carboxylate (CID 8012668) is [(E)-3-phenylprop-2-enyl] 1,3-benzodioxole-5-carboxylate.
What is the SMILES notation for [(E)-3-phenylprop-2-enyl] 1,3-benzodioxole-5-carboxylate?
The canonical SMILES for [(E)-3-phenylprop-2-enyl] 1,3-benzodioxole-5-carboxylate is O=C(OC/C=C/c1ccccc1)c1ccc2c(c1)OCO2.
What is the InChIKey of [(E)-3-phenylprop-2-enyl] 1,3-benzodioxole-5-carboxylate?
The InChIKey is UIUAGJIJOQOQKE-QPJJXVBHSA-N. The full InChI is InChI=1S/C17H14O4/c18-17(14-8-9-15-16(11-14)21-12-20-15)19-10-4-7-13-5-2-1-3-6-13/h1-9,11H,10,12H2/b7-4+.
What are the key properties of [(E)-3-phenylprop-2-enyl] 1,3-benzodioxole-5-carboxylate?
[(E)-3-phenylprop-2-enyl] 1,3-benzodioxole-5-carboxylate has a molecular weight of 282.29 g/mol, XLogP of 3.29, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-3-phenylprop-2-enyl] 1,3-benzodioxole-5-carboxylate is sourced from PubChem (CID 8012668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).