C17H14O4 — CID 8012668
[(E)-3-phenylprop-2-enyl] 1,3-benzodioxole-5-carboxylate (PubChem CID 8012668) has the molecular formula C17H14O4 and a molecular weight of 282.29 g/mol. Its IUPAC name is [(E)-3-phenylprop-2-enyl] 1,3-benzodioxole-5-carboxylate.
| Compound Name | [(E)-3-phenylprop-2-enyl] 1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 8012668 |
| Molecular Formula | C17H14O4 |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | [(E)-3-phenylprop-2-enyl] 1,3-benzodioxole-5-carboxylate |
| SMILES | O=C(OC/C=C/c1ccccc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H14O4/c18-17(14-8-9-15-16(11-14)21-12-20-15)19-10-4-7-13-5-2-1-3-6-13/h1-9,11H,10,12H2/b7-4+ |
| InChIKey | UIUAGJIJOQOQKE-QPJJXVBHSA-N |
| XLogP | 3.29 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |