C19H18O2S2 — CID 78535520
3-phenylprop-2-enyl 4-(1,3-dithiolan-2-yl)benzoate (PubChem CID 78535520) has the molecular formula C19H18O2S2 and a molecular weight of 342.48 g/mol. Its IUPAC name is 3-phenylprop-2-enyl 4-(1,3-dithiolan-2-yl)benzoate.
| Compound Name | 3-phenylprop-2-enyl 4-(1,3-dithiolan-2-yl)benzoate |
|---|---|
| PubChem CID | 78535520 |
| Molecular Formula | C19H18O2S2 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | 3-phenylprop-2-enyl 4-(1,3-dithiolan-2-yl)benzoate |
| SMILES | O=C(OCC=Cc1ccccc1)c1ccc(C2SCCS2)cc1 |
| InChI | InChI=1S/C19H18O2S2/c20-18(21-12-4-7-15-5-2-1-3-6-15)16-8-10-17(11-9-16)19-22-13-14-23-19/h1-11,19H,12-14H2 |
| InChIKey | PMFKYMFXAWWSTC-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |