C18H15FO3S2 — CID 7744518
[2-(2-fluorophenyl)-2-oxoethyl] 4-(1,3-dithiolan-2-yl)benzoate (PubChem CID 7744518) has the molecular formula C18H15FO3S2 and a molecular weight of 362.45 g/mol. Its IUPAC name is [2-(2-fluorophenyl)-2-oxoethyl] 4-(1,3-dithiolan-2-yl)benzoate.
| Compound Name | [2-(2-fluorophenyl)-2-oxoethyl] 4-(1,3-dithiolan-2-yl)benzoate |
|---|---|
| PubChem CID | 7744518 |
| Molecular Formula | C18H15FO3S2 |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.04 |
| IUPAC Name | [2-(2-fluorophenyl)-2-oxoethyl] 4-(1,3-dithiolan-2-yl)benzoate |
| SMILES | O=C(OCC(=O)c1ccccc1F)c1ccc(C2SCCS2)cc1 |
| InChI | InChI=1S/C18H15FO3S2/c19-15-4-2-1-3-14(15)16(20)11-22-17(21)12-5-7-13(8-6-12)18-23-9-10-24-18/h1-8,18H,9-11H2 |
| InChIKey | PHVFTYAUBGSVSZ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |