C20H20O4S2 — CID 7744221
[2-(4-ethoxyphenyl)-2-oxoethyl] 4-(1,3-dithiolan-2-yl)benzoate (PubChem CID 7744221) has the molecular formula C20H20O4S2 and a molecular weight of 388.51 g/mol. Its IUPAC name is [2-(4-ethoxyphenyl)-2-oxoethyl] 4-(1,3-dithiolan-2-yl)benzoate.
| Compound Name | [2-(4-ethoxyphenyl)-2-oxoethyl] 4-(1,3-dithiolan-2-yl)benzoate |
|---|---|
| PubChem CID | 7744221 |
| Molecular Formula | C20H20O4S2 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | [2-(4-ethoxyphenyl)-2-oxoethyl] 4-(1,3-dithiolan-2-yl)benzoate |
| SMILES | CCOc1ccc(C(=O)COC(=O)c2ccc(C3SCCS3)cc2)cc1 |
| InChI | InChI=1S/C20H20O4S2/c1-2-23-17-9-7-14(8-10-17)18(21)13-24-19(22)15-3-5-16(6-4-15)20-25-11-12-26-20/h3-10,20H,2,11-13H2,1H3 |
| InChIKey | OMLKZAJNXFDILD-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |