C17H16O3S3 — CID 8595075
(2-oxo-2-thiophen-2-ylethyl) 4-(1,3-dithian-2-yl)benzoate (PubChem CID 8595075) has the molecular formula C17H16O3S3 and a molecular weight of 364.51 g/mol. Its IUPAC name is (2-oxo-2-thiophen-2-ylethyl) 4-(1,3-dithian-2-yl)benzoate.
| Compound Name | (2-oxo-2-thiophen-2-ylethyl) 4-(1,3-dithian-2-yl)benzoate |
|---|---|
| PubChem CID | 8595075 |
| Molecular Formula | C17H16O3S3 |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.03 |
| IUPAC Name | (2-oxo-2-thiophen-2-ylethyl) 4-(1,3-dithian-2-yl)benzoate |
| SMILES | O=C(OCC(=O)c1cccs1)c1ccc(C2SCCCS2)cc1 |
| InChI | InChI=1S/C17H16O3S3/c18-14(15-3-1-8-21-15)11-20-16(19)12-4-6-13(7-5-12)17-22-9-2-10-23-17/h1,3-8,17H,2,9-11H2 |
| InChIKey | UZNJLXBNDZRHEB-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |