C22H25NO3S2 — CID 8595614
[2-oxo-2-[[(2S)-2-phenylpropyl]amino]ethyl] 4-(1,3-dithian-2-yl)benzoate (PubChem CID 8595614) has the molecular formula C22H25NO3S2 and a molecular weight of 415.58 g/mol. Its IUPAC name is [2-oxo-2-[[(2S)-2-phenylpropyl]amino]ethyl] 4-(1,3-dithian-2-yl)benzoate.
| Compound Name | [2-oxo-2-[[(2S)-2-phenylpropyl]amino]ethyl] 4-(1,3-dithian-2-yl)benzoate |
|---|---|
| PubChem CID | 8595614 |
| Molecular Formula | C22H25NO3S2 |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | [2-oxo-2-[[(2S)-2-phenylpropyl]amino]ethyl] 4-(1,3-dithian-2-yl)benzoate |
| SMILES | C[C@H](CNC(=O)COC(=O)c1ccc(C2SCCCS2)cc1)c1ccccc1 |
| InChI | InChI=1S/C22H25NO3S2/c1-16(17-6-3-2-4-7-17)14-23-20(24)15-26-21(25)18-8-10-19(11-9-18)22-27-12-5-13-28-22/h2-4,6-11,16,22H,5,12-15H2,1H3,(H,23,24)/t16-/m1/s1 |
| InChIKey | MOOBDNPWZAIYOV-MRXNPFEDSA-N |
| XLogP | 4.63 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |