C24H23NO4 — CID 7133512
[2-oxo-2-[[(2S)-2-phenylpropyl]amino]ethyl] 4-(4-hydroxyphenyl)benzoate (PubChem CID 7133512) has the molecular formula C24H23NO4 and a molecular weight of 389.45 g/mol. Its IUPAC name is [2-oxo-2-[[(2S)-2-phenylpropyl]amino]ethyl] 4-(4-hydroxyphenyl)benzoate.
| Compound Name | [2-oxo-2-[[(2S)-2-phenylpropyl]amino]ethyl] 4-(4-hydroxyphenyl)benzoate |
|---|---|
| PubChem CID | 7133512 |
| Molecular Formula | C24H23NO4 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | [2-oxo-2-[[(2S)-2-phenylpropyl]amino]ethyl] 4-(4-hydroxyphenyl)benzoate |
| SMILES | C[C@H](CNC(=O)COC(=O)c1ccc(-c2ccc(O)cc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C24H23NO4/c1-17(18-5-3-2-4-6-18)15-25-23(27)16-29-24(28)21-9-7-19(8-10-21)20-11-13-22(26)14-12-20/h2-14,17,26H,15-16H2,1H3,(H,25,27)/t17-/m1/s1 |
| InChIKey | KHNILQRTUAHKNZ-QGZVFWFLSA-N |
| XLogP | 4.14 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |