C19H19F2NO5S — CID 7679735
[2-oxo-2-[[(2S)-2-phenylpropyl]amino]ethyl] 4-(difluoromethylsulfonyl)benzoate (PubChem CID 7679735) has the molecular formula C19H19F2NO5S and a molecular weight of 411.43 g/mol. Its IUPAC name is [2-oxo-2-[[(2S)-2-phenylpropyl]amino]ethyl] 4-(difluoromethylsulfonyl)benzoate.
| Compound Name | [2-oxo-2-[[(2S)-2-phenylpropyl]amino]ethyl] 4-(difluoromethylsulfonyl)benzoate |
|---|---|
| PubChem CID | 7679735 |
| Molecular Formula | C19H19F2NO5S |
| Molecular Weight | 411.43 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | [2-oxo-2-[[(2S)-2-phenylpropyl]amino]ethyl] 4-(difluoromethylsulfonyl)benzoate |
| SMILES | C[C@H](CNC(=O)COC(=O)c1ccc(S(=O)(=O)C(F)F)cc1)c1ccccc1 |
| InChI | InChI=1S/C19H19F2NO5S/c1-13(14-5-3-2-4-6-14)11-22-17(23)12-27-18(24)15-7-9-16(10-8-15)28(25,26)19(20)21/h2-10,13,19H,11-12H2,1H3,(H,22,23)/t13-/m1/s1 |
| InChIKey | WOMQOAMFFXHZQW-CYBMUJFWSA-N |
| XLogP | 2.76 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.43 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |