C15H13F2NO5S2 — CID 2499455
[2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 4-(difluoromethylsulfonyl)benzoate (PubChem CID 2499455) has the molecular formula C15H13F2NO5S2 and a molecular weight of 389.40 g/mol. Its IUPAC name is [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 4-(difluoromethylsulfonyl)benzoate.
| Compound Name | [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 4-(difluoromethylsulfonyl)benzoate |
|---|---|
| PubChem CID | 2499455 |
| Molecular Formula | C15H13F2NO5S2 |
| Molecular Weight | 389.40 g/mol |
| Exact Mass | 389.02 |
| IUPAC Name | [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 4-(difluoromethylsulfonyl)benzoate |
| SMILES | O=C(COC(=O)c1ccc(S(=O)(=O)C(F)F)cc1)NCc1cccs1 |
| InChI | InChI=1S/C15H13F2NO5S2/c16-15(17)25(21,22)12-5-3-10(4-6-12)14(20)23-9-13(19)18-8-11-2-1-7-24-11/h1-7,15H,8-9H2,(H,18,19) |
| InChIKey | BRDZTGODBFKMGP-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.40 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |