C18H16F2N2O6S — CID 2499383
[2-(benzylcarbamoylamino)-2-oxoethyl] 4-(difluoromethylsulfonyl)benzoate (PubChem CID 2499383) has the molecular formula C18H16F2N2O6S and a molecular weight of 426.40 g/mol. Its IUPAC name is [2-(benzylcarbamoylamino)-2-oxoethyl] 4-(difluoromethylsulfonyl)benzoate.
| Compound Name | [2-(benzylcarbamoylamino)-2-oxoethyl] 4-(difluoromethylsulfonyl)benzoate |
|---|---|
| PubChem CID | 2499383 |
| Molecular Formula | C18H16F2N2O6S |
| Molecular Weight | 426.40 g/mol |
| Exact Mass | 426.07 |
| IUPAC Name | [2-(benzylcarbamoylamino)-2-oxoethyl] 4-(difluoromethylsulfonyl)benzoate |
| SMILES | O=C(COC(=O)c1ccc(S(=O)(=O)C(F)F)cc1)NC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C18H16F2N2O6S/c19-17(20)29(26,27)14-8-6-13(7-9-14)16(24)28-11-15(23)22-18(25)21-10-12-4-2-1-3-5-12/h1-9,17H,10-11H2,(H2,21,22,23,25) |
| InChIKey | DHZWBWMYJXDEEO-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.40 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |