C15H18F2N2O6S — CID 7680181
[2-[[(2S)-butan-2-yl]carbamoylamino]-2-oxoethyl] 4-(difluoromethylsulfonyl)benzoate (PubChem CID 7680181) has the molecular formula C15H18F2N2O6S and a molecular weight of 392.38 g/mol. Its IUPAC name is [2-[[(2S)-butan-2-yl]carbamoylamino]-2-oxoethyl] 4-(difluoromethylsulfonyl)benzoate.
| Compound Name | [2-[[(2S)-butan-2-yl]carbamoylamino]-2-oxoethyl] 4-(difluoromethylsulfonyl)benzoate |
|---|---|
| PubChem CID | 7680181 |
| Molecular Formula | C15H18F2N2O6S |
| Molecular Weight | 392.38 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | [2-[[(2S)-butan-2-yl]carbamoylamino]-2-oxoethyl] 4-(difluoromethylsulfonyl)benzoate |
| SMILES | CC[C@H](C)NC(=O)NC(=O)COC(=O)c1ccc(S(=O)(=O)C(F)F)cc1 |
| InChI | InChI=1S/C15H18F2N2O6S/c1-3-9(2)18-15(22)19-12(20)8-25-13(21)10-4-6-11(7-5-10)26(23,24)14(16)17/h4-7,9,14H,3,8H2,1-2H3,(H2,18,19,20,22)/t9-/m0/s1 |
| InChIKey | PXLHNSSJXDETES-VIFPVBQESA-N |
| XLogP | 1.46 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.38 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |