C15H19FN2O5 — CID 8702748
[2-[[(2R)-butan-2-yl]carbamoylamino]-2-oxoethyl] 3-fluoro-4-methoxybenzoate (PubChem CID 8702748) has the molecular formula C15H19FN2O5 and a molecular weight of 326.32 g/mol. Its IUPAC name is [2-[[(2R)-butan-2-yl]carbamoylamino]-2-oxoethyl] 3-fluoro-4-methoxybenzoate.
| Compound Name | [2-[[(2R)-butan-2-yl]carbamoylamino]-2-oxoethyl] 3-fluoro-4-methoxybenzoate |
|---|---|
| PubChem CID | 8702748 |
| Molecular Formula | C15H19FN2O5 |
| Molecular Weight | 326.32 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | [2-[[(2R)-butan-2-yl]carbamoylamino]-2-oxoethyl] 3-fluoro-4-methoxybenzoate |
| SMILES | CC[C@@H](C)NC(=O)NC(=O)COC(=O)c1ccc(OC)c(F)c1 |
| InChI | InChI=1S/C15H19FN2O5/c1-4-9(2)17-15(21)18-13(19)8-23-14(20)10-5-6-12(22-3)11(16)7-10/h5-7,9H,4,8H2,1-3H3,(H2,17,18,19,21)/t9-/m1/s1 |
| InChIKey | KAQCMZVDFDDRPY-SECBINFHSA-N |
| XLogP | 1.62 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.32 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |