C17H14FNO5 — CID 8702579
(2-benzamido-2-oxoethyl) 3-fluoro-4-methoxybenzoate (PubChem CID 8702579) has the molecular formula C17H14FNO5 and a molecular weight of 331.30 g/mol. Its IUPAC name is (2-benzamido-2-oxoethyl) 3-fluoro-4-methoxybenzoate.
| Compound Name | (2-benzamido-2-oxoethyl) 3-fluoro-4-methoxybenzoate |
|---|---|
| PubChem CID | 8702579 |
| Molecular Formula | C17H14FNO5 |
| Molecular Weight | 331.30 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | (2-benzamido-2-oxoethyl) 3-fluoro-4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)OCC(=O)NC(=O)c2ccccc2)cc1F |
| InChI | InChI=1S/C17H14FNO5/c1-23-14-8-7-12(9-13(14)18)17(22)24-10-15(20)19-16(21)11-5-3-2-4-6-11/h2-9H,10H2,1H3,(H,19,20,21) |
| InChIKey | LUURIZMWNYEBOL-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.30 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |