C18H16F3NO5S — CID 2554943
[2-[2-(4-fluorophenyl)ethylamino]-2-oxoethyl] 4-(difluoromethylsulfonyl)benzoate (PubChem CID 2554943) has the molecular formula C18H16F3NO5S and a molecular weight of 415.39 g/mol. Its IUPAC name is [2-[2-(4-fluorophenyl)ethylamino]-2-oxoethyl] 4-(difluoromethylsulfonyl)benzoate.
| Compound Name | [2-[2-(4-fluorophenyl)ethylamino]-2-oxoethyl] 4-(difluoromethylsulfonyl)benzoate |
|---|---|
| PubChem CID | 2554943 |
| Molecular Formula | C18H16F3NO5S |
| Molecular Weight | 415.39 g/mol |
| Exact Mass | 415.07 |
| IUPAC Name | [2-[2-(4-fluorophenyl)ethylamino]-2-oxoethyl] 4-(difluoromethylsulfonyl)benzoate |
| SMILES | O=C(COC(=O)c1ccc(S(=O)(=O)C(F)F)cc1)NCCc1ccc(F)cc1 |
| InChI | InChI=1S/C18H16F3NO5S/c19-14-5-1-12(2-6-14)9-10-22-16(23)11-27-17(24)13-3-7-15(8-4-13)28(25,26)18(20)21/h1-8,18H,9-11H2,(H,22,23) |
| InChIKey | FEMPCAKZKULESJ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.39 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |