C17H14Cl2FNO3 — CID 2364423
[2-[2-(4-fluorophenyl)ethylamino]-2-oxoethyl] 3,5-dichlorobenzoate (PubChem CID 2364423) has the molecular formula C17H14Cl2FNO3 and a molecular weight of 370.21 g/mol. Its IUPAC name is [2-[2-(4-fluorophenyl)ethylamino]-2-oxoethyl] 3,5-dichlorobenzoate.
| Compound Name | [2-[2-(4-fluorophenyl)ethylamino]-2-oxoethyl] 3,5-dichlorobenzoate |
|---|---|
| PubChem CID | 2364423 |
| Molecular Formula | C17H14Cl2FNO3 |
| Molecular Weight | 370.21 g/mol |
| Exact Mass | 369.03 |
| IUPAC Name | [2-[2-(4-fluorophenyl)ethylamino]-2-oxoethyl] 3,5-dichlorobenzoate |
| SMILES | O=C(COC(=O)c1cc(Cl)cc(Cl)c1)NCCc1ccc(F)cc1 |
| InChI | InChI=1S/C17H14Cl2FNO3/c18-13-7-12(8-14(19)9-13)17(23)24-10-16(22)21-6-5-11-1-3-15(20)4-2-11/h1-4,7-9H,5-6,10H2,(H,21,22) |
| InChIKey | JQPZXNKSWGNDER-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.21 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |