C16H13Cl2FN2O3 — CID 2357999
[2-[2-(4-fluorophenyl)ethylamino]-2-oxoethyl] 2,6-dichloropyridine-4-carboxylate (PubChem CID 2357999) has the molecular formula C16H13Cl2FN2O3 and a molecular weight of 371.20 g/mol. Its IUPAC name is [2-[2-(4-fluorophenyl)ethylamino]-2-oxoethyl] 2,6-dichloropyridine-4-carboxylate.
| Compound Name | [2-[2-(4-fluorophenyl)ethylamino]-2-oxoethyl] 2,6-dichloropyridine-4-carboxylate |
|---|---|
| PubChem CID | 2357999 |
| Molecular Formula | C16H13Cl2FN2O3 |
| Molecular Weight | 371.20 g/mol |
| Exact Mass | 370.03 |
| IUPAC Name | [2-[2-(4-fluorophenyl)ethylamino]-2-oxoethyl] 2,6-dichloropyridine-4-carboxylate |
| SMILES | O=C(COC(=O)c1cc(Cl)nc(Cl)c1)NCCc1ccc(F)cc1 |
| InChI | InChI=1S/C16H13Cl2FN2O3/c17-13-7-11(8-14(18)21-13)16(23)24-9-15(22)20-6-5-10-1-3-12(19)4-2-10/h1-4,7-8H,5-6,9H2,(H,20,22) |
| InChIKey | CSMRRNWYNHHBOK-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.20 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|