C16H11F3O5S — CID 2665366
[2-(4-fluorophenyl)-2-oxoethyl] 4-(difluoromethylsulfonyl)benzoate (PubChem CID 2665366) has the molecular formula C16H11F3O5S and a molecular weight of 372.32 g/mol. Its IUPAC name is [2-(4-fluorophenyl)-2-oxoethyl] 4-(difluoromethylsulfonyl)benzoate.
| Compound Name | [2-(4-fluorophenyl)-2-oxoethyl] 4-(difluoromethylsulfonyl)benzoate |
|---|---|
| PubChem CID | 2665366 |
| Molecular Formula | C16H11F3O5S |
| Molecular Weight | 372.32 g/mol |
| Exact Mass | 372.03 |
| IUPAC Name | [2-(4-fluorophenyl)-2-oxoethyl] 4-(difluoromethylsulfonyl)benzoate |
| SMILES | O=C(COC(=O)c1ccc(S(=O)(=O)C(F)F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H11F3O5S/c17-12-5-1-10(2-6-12)14(20)9-24-15(21)11-3-7-13(8-4-11)25(22,23)16(18)19/h1-8,16H,9H2 |
| InChIKey | KZNNLAWEPZUQGH-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.32 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |