C17H14F2O6S — CID 7679711
[2-(2-methoxyphenyl)-2-oxoethyl] 4-(difluoromethylsulfonyl)benzoate (PubChem CID 7679711) has the molecular formula C17H14F2O6S and a molecular weight of 384.36 g/mol. Its IUPAC name is [2-(2-methoxyphenyl)-2-oxoethyl] 4-(difluoromethylsulfonyl)benzoate.
| Compound Name | [2-(2-methoxyphenyl)-2-oxoethyl] 4-(difluoromethylsulfonyl)benzoate |
|---|---|
| PubChem CID | 7679711 |
| Molecular Formula | C17H14F2O6S |
| Molecular Weight | 384.36 g/mol |
| Exact Mass | 384.05 |
| IUPAC Name | [2-(2-methoxyphenyl)-2-oxoethyl] 4-(difluoromethylsulfonyl)benzoate |
| SMILES | COc1ccccc1C(=O)COC(=O)c1ccc(S(=O)(=O)C(F)F)cc1 |
| InChI | InChI=1S/C17H14F2O6S/c1-24-15-5-3-2-4-13(15)14(20)10-25-16(21)11-6-8-12(9-7-11)26(22,23)17(18)19/h2-9,17H,10H2,1H3 |
| InChIKey | MTNBWZGGAIHPTB-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.36 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |