C17H16F2O6S — CID 9096959
(3,4-dimethoxyphenyl)methyl 4-(difluoromethylsulfonyl)benzoate (PubChem CID 9096959) has the molecular formula C17H16F2O6S and a molecular weight of 386.37 g/mol. Its IUPAC name is (3,4-dimethoxyphenyl)methyl 4-(difluoromethylsulfonyl)benzoate.
| Compound Name | (3,4-dimethoxyphenyl)methyl 4-(difluoromethylsulfonyl)benzoate |
|---|---|
| PubChem CID | 9096959 |
| Molecular Formula | C17H16F2O6S |
| Molecular Weight | 386.37 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | (3,4-dimethoxyphenyl)methyl 4-(difluoromethylsulfonyl)benzoate |
| SMILES | COc1ccc(COC(=O)c2ccc(S(=O)(=O)C(F)F)cc2)cc1OC |
| InChI | InChI=1S/C17H16F2O6S/c1-23-14-8-3-11(9-15(14)24-2)10-25-16(20)12-4-6-13(7-5-12)26(21,22)17(18)19/h3-9,17H,10H2,1-2H3 |
| InChIKey | ZXSWTJRGNQPUTQ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.37 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |