C16H14F2O7S — CID 7679809
methyl 5-[[4-(difluoromethylsulfonyl)benzoyl]oxymethyl]-2-methylfuran-3-carboxylate (PubChem CID 7679809) has the molecular formula C16H14F2O7S and a molecular weight of 388.34 g/mol. Its IUPAC name is methyl 5-[[4-(difluoromethylsulfonyl)benzoyl]oxymethyl]-2-methylfuran-3-carboxylate.
| Compound Name | methyl 5-[[4-(difluoromethylsulfonyl)benzoyl]oxymethyl]-2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 7679809 |
| Molecular Formula | C16H14F2O7S |
| Molecular Weight | 388.34 g/mol |
| Exact Mass | 388.04 |
| IUPAC Name | methyl 5-[[4-(difluoromethylsulfonyl)benzoyl]oxymethyl]-2-methylfuran-3-carboxylate |
| SMILES | COC(=O)c1cc(COC(=O)c2ccc(S(=O)(=O)C(F)F)cc2)oc1C |
| InChI | InChI=1S/C16H14F2O7S/c1-9-13(15(20)23-2)7-11(25-9)8-24-14(19)10-3-5-12(6-4-10)26(21,22)16(17)18/h3-7,16H,8H2,1-2H3 |
| InChIKey | LTVISGSTEMEMSY-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 99.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.34 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |