C17H17ClO7S — CID 9491362
methyl 5-[3-(4-chlorophenyl)sulfonylpropanoyloxymethyl]-2-methylfuran-3-carboxylate (PubChem CID 9491362) has the molecular formula C17H17ClO7S and a molecular weight of 400.84 g/mol. Its IUPAC name is methyl 5-[3-(4-chlorophenyl)sulfonylpropanoyloxymethyl]-2-methylfuran-3-carboxylate.
| Compound Name | methyl 5-[3-(4-chlorophenyl)sulfonylpropanoyloxymethyl]-2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 9491362 |
| Molecular Formula | C17H17ClO7S |
| Molecular Weight | 400.84 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | methyl 5-[3-(4-chlorophenyl)sulfonylpropanoyloxymethyl]-2-methylfuran-3-carboxylate |
| SMILES | COC(=O)c1cc(COC(=O)CCS(=O)(=O)c2ccc(Cl)cc2)oc1C |
| InChI | InChI=1S/C17H17ClO7S/c1-11-15(17(20)23-2)9-13(25-11)10-24-16(19)7-8-26(21,22)14-5-3-12(18)4-6-14/h3-6,9H,7-8,10H2,1-2H3 |
| InChIKey | GEXZHFNFALQQFW-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 99.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.84 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |