C19H21NO3 — CID 7971711
[2-oxo-2-[[(2R)-2-phenylpropyl]amino]ethyl] 4-methylbenzoate (PubChem CID 7971711) has the molecular formula C19H21NO3 and a molecular weight of 311.38 g/mol. Its IUPAC name is [2-oxo-2-[[(2R)-2-phenylpropyl]amino]ethyl] 4-methylbenzoate.
| Compound Name | [2-oxo-2-[[(2R)-2-phenylpropyl]amino]ethyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 7971711 |
| Molecular Formula | C19H21NO3 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | [2-oxo-2-[[(2R)-2-phenylpropyl]amino]ethyl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OCC(=O)NC[C@H](C)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H21NO3/c1-14-8-10-17(11-9-14)19(22)23-13-18(21)20-12-15(2)16-6-4-3-5-7-16/h3-11,15H,12-13H2,1-2H3,(H,20,21)/t15-/m0/s1 |
| InChIKey | DSMCVJAOEBRELL-HNNXBMFYSA-N |
| XLogP | 3.07 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |