About 3-phenylprop-2-enyl 3-bromobenzoate
3-phenylprop-2-enyl 3-bromobenzoate (PubChem CID 4616313) has the molecular formula C16H13BrO2
and a molecular weight of 317.18 g/mol. Its IUPAC name is 3-phenylprop-2-enyl 3-bromobenzoate.
Molecular Properties
| Compound Name | 3-phenylprop-2-enyl 3-bromobenzoate |
| PubChem CID | 4616313 |
| Molecular Formula | C16H13BrO2 |
| Molecular Weight | 317.18 g/mol |
| Exact Mass | 316.01 |
| IUPAC Name | 3-phenylprop-2-enyl 3-bromobenzoate |
| SMILES | O=C(OCC=Cc1ccccc1)c1cccc(Br)c1 |
| InChI | InChI=1S/C16H13BrO2/c17-15-10-4-9-14(12-15)16(18)19-11-5-8-13-6-2-1-3-7-13/h1-10,12H,11H2 |
| InChIKey | KMANMVXNSJWTBO-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.18 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-phenylprop-2-enyl 3-bromobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenylprop-2-enyl 3-bromobenzoate?
The IUPAC name of 3-phenylprop-2-enyl 3-bromobenzoate (CID 4616313) is 3-phenylprop-2-enyl 3-bromobenzoate.
What is the SMILES notation for 3-phenylprop-2-enyl 3-bromobenzoate?
The canonical SMILES for 3-phenylprop-2-enyl 3-bromobenzoate is O=C(OCC=Cc1ccccc1)c1cccc(Br)c1.
What is the InChIKey of 3-phenylprop-2-enyl 3-bromobenzoate?
The InChIKey is KMANMVXNSJWTBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13BrO2/c17-15-10-4-9-14(12-15)16(18)19-11-5-8-13-6-2-1-3-7-13/h1-10,12H,11H2.
What are the key properties of 3-phenylprop-2-enyl 3-bromobenzoate?
3-phenylprop-2-enyl 3-bromobenzoate has a molecular weight of 317.18 g/mol, XLogP of 4.32, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylprop-2-enyl 3-bromobenzoate is sourced from PubChem (CID 4616313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).