C24H40O5 — CID 70194040
acetic acid;[(2E)-3,7-dimethylocta-2,6-dienyl] acetate;1,7,7-trimethylbicyclo[2.2.1]heptan-2-one (PubChem CID 70194040) has the molecular formula C24H40O5 and a molecular weight of 408.58 g/mol. Its IUPAC name is acetic acid;[(2E)-3,7-dimethylocta-2,6-dienyl] acetate;1,7,7-trimethylbicyclo[2.2.1]heptan-2-one.
| Compound Name | acetic acid;[(2E)-3,7-dimethylocta-2,6-dienyl] acetate;1,7,7-trimethylbicyclo[2.2.1]heptan-2-one |
|---|---|
| PubChem CID | 70194040 |
| Molecular Formula | C24H40O5 |
| Molecular Weight | 408.58 g/mol |
| Exact Mass | 408.29 |
| IUPAC Name | acetic acid;[(2E)-3,7-dimethylocta-2,6-dienyl] acetate;1,7,7-trimethylbicyclo[2.2.1]heptan-2-one |
| SMILES | CC(=O)O.CC(=O)OC/C=C(\C)CCC=C(C)C.CC12CCC(CC1=O)C2(C)C |
| InChI | InChI=1S/C12H20O2.C10H16O.C2H4O2/c1-10(2)6-5-7-11(3)8-9-14-12(4)13;1-9(2)7-4-5-10(9,3)8(11)6-7;1-2(3)4/h6,8H,5,7,9H2,1-4H3;7H,4-6H2,1-3H3;1H3,(H,3,4)/b11-8+;; |
| InChIKey | XFMRAZIAKRWINP-OHENRDTHSA-N |
| XLogP | 5.73 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.58 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|