About 1,7,7-trimethylbicyclo[2.2.1]heptan-2-one;urea
1,7,7-trimethylbicyclo[2.2.1]heptan-2-one;urea (PubChem CID 162060866) has the molecular formula C11H20N2O2
and a molecular weight of 212.29 g/mol. Its IUPAC name is 1,7,7-trimethylbicyclo[2.2.1]heptan-2-one;urea.
Molecular Properties
| Compound Name | 1,7,7-trimethylbicyclo[2.2.1]heptan-2-one;urea |
| PubChem CID | 162060866 |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | 1,7,7-trimethylbicyclo[2.2.1]heptan-2-one;urea |
| SMILES | CC12CCC(CC1=O)C2(C)C.NC(N)=O |
| InChI | InChI=1S/C10H16O.CH4N2O/c1-9(2)7-4-5-10(9,3)8(11)6-7;2-1(3)4/h7H,4-6H2,1-3H3;(H4,2,3,4) |
| InChIKey | YZVAJNRCRBXKSL-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,7,7-trimethylbicyclo[2.2.1]heptan-2-one;urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,7,7-trimethylbicyclo[2.2.1]heptan-2-one;urea?
The IUPAC name of 1,7,7-trimethylbicyclo[2.2.1]heptan-2-one;urea (CID 162060866) is 1,7,7-trimethylbicyclo[2.2.1]heptan-2-one;urea.
What is the SMILES notation for 1,7,7-trimethylbicyclo[2.2.1]heptan-2-one;urea?
The canonical SMILES for 1,7,7-trimethylbicyclo[2.2.1]heptan-2-one;urea is CC12CCC(CC1=O)C2(C)C.NC(N)=O.
What is the InChIKey of 1,7,7-trimethylbicyclo[2.2.1]heptan-2-one;urea?
The InChIKey is YZVAJNRCRBXKSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O.CH4N2O/c1-9(2)7-4-5-10(9,3)8(11)6-7;2-1(3)4/h7H,4-6H2,1-3H3;(H4,2,3,4).
What are the key properties of 1,7,7-trimethylbicyclo[2.2.1]heptan-2-one;urea?
1,7,7-trimethylbicyclo[2.2.1]heptan-2-one;urea has a molecular weight of 212.29 g/mol, XLogP of 1.43, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,7,7-trimethylbicyclo[2.2.1]heptan-2-one;urea is sourced from PubChem (CID 162060866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).