C11H20N2O2 — CID 162060866
1,7,7-trimethylbicyclo[2.2.1]heptan-2-one;urea (PubChem CID 162060866) has the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. Its IUPAC name is 1,7,7-trimethylbicyclo[2.2.1]heptan-2-one;urea.
| Compound Name | 1,7,7-trimethylbicyclo[2.2.1]heptan-2-one;urea |
|---|---|
| PubChem CID | 162060866 |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | 1,7,7-trimethylbicyclo[2.2.1]heptan-2-one;urea |
| SMILES | CC12CCC(CC1=O)C2(C)C.NC(N)=O |
| InChI | InChI=1S/C10H16O.CH4N2O/c1-9(2)7-4-5-10(9,3)8(11)6-7;2-1(3)4/h7H,4-6H2,1-3H3;(H4,2,3,4) |
| InChIKey | YZVAJNRCRBXKSL-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |