C28H38O6 — CID 158933619
terephthalic acid;bis(1,7,7-trimethylbicyclo[2.2.1]heptan-2-one) (PubChem CID 158933619) has the molecular formula C28H38O6 and a molecular weight of 470.61 g/mol. Its IUPAC name is terephthalic acid;bis(1,7,7-trimethylbicyclo[2.2.1]heptan-2-one).
| Compound Name | terephthalic acid;bis(1,7,7-trimethylbicyclo[2.2.1]heptan-2-one) |
|---|---|
| PubChem CID | 158933619 |
| Molecular Formula | C28H38O6 |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.27 |
| IUPAC Name | terephthalic acid;bis(1,7,7-trimethylbicyclo[2.2.1]heptan-2-one) |
| SMILES | CC12CCC(CC1=O)C2(C)C.CC12CCC(CC1=O)C2(C)C.O=C(O)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/2C10H16O.C8H6O4/c2*1-9(2)7-4-5-10(9,3)8(11)6-7;9-7(10)5-1-2-6(4-3-5)8(11)12/h2*7H,4-6H2,1-3H3;1-4H,(H,9,10)(H,11,12) |
| InChIKey | JJJJVIRQUYHDJI-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |