C11H23NO5S — CID 160904354
azanium;methyl sulfate;1,7,7-trimethylbicyclo[2.2.1]heptan-2-one (PubChem CID 160904354) has the molecular formula C11H23NO5S and a molecular weight of 281.37 g/mol. Its IUPAC name is azanium;methyl sulfate;1,7,7-trimethylbicyclo[2.2.1]heptan-2-one.
| Compound Name | azanium;methyl sulfate;1,7,7-trimethylbicyclo[2.2.1]heptan-2-one |
|---|---|
| PubChem CID | 160904354 |
| Molecular Formula | C11H23NO5S |
| Molecular Weight | 281.37 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | azanium;methyl sulfate;1,7,7-trimethylbicyclo[2.2.1]heptan-2-one |
| SMILES | CC12CCC(CC1=O)C2(C)C.COS(=O)(=O)[O-].[NH4+] |
| InChI | InChI=1S/C10H16O.CH4O4S.H3N/c1-9(2)7-4-5-10(9,3)8(11)6-7;1-5-6(2,3)4;/h7H,4-6H2,1-3H3;1H3,(H,2,3,4);1H3 |
| InChIKey | SPXUOKWFASBYJP-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 120.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.37 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|