C9H13O4S- — CID 59415686
(1S,4R)-7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-sulfonate (PubChem CID 59415686) has the molecular formula C9H13O4S- and a molecular weight of 217.27 g/mol. Its IUPAC name is (1S,4R)-7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-sulfonate.
| Compound Name | (1S,4R)-7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-sulfonate |
|---|---|
| PubChem CID | 59415686 |
| Molecular Formula | C9H13O4S- |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.05 |
| IUPAC Name | (1S,4R)-7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-sulfonate |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(S(=O)(=O)[O-])C(=O)C2 |
| InChI | InChI=1S/C9H14O4S/c1-8(2)6-3-4-9(8,7(10)5-6)14(11,12)13/h6H,3-5H2,1-2H3,(H,11,12,13)/p-1/t6-,9-/m1/s1 |
| InChIKey | IXWZXBXSJGVUDC-HZGVNTEJSA-M |
| XLogP | 0.68 |
| TPSA | 74.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|