C9H14O4S — CID 12817179
7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-sulfonic acid (PubChem CID 12817179) has the molecular formula C9H14O4S and a molecular weight of 218.27 g/mol. Its IUPAC name is 7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-sulfonic acid.
| Compound Name | 7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-sulfonic acid |
|---|---|
| PubChem CID | 12817179 |
| Molecular Formula | C9H14O4S |
| Molecular Weight | 218.27 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | 7,7-dimethyl-2-oxobicyclo[2.2.1]heptane-1-sulfonic acid |
| SMILES | CC1(C)C2CCC1(S(=O)(=O)O)C(=O)C2 |
| InChI | InChI=1S/C9H14O4S/c1-8(2)6-3-4-9(8,7(10)5-6)14(11,12)13/h6H,3-5H2,1-2H3,(H,11,12,13) |
| InChIKey | IXWZXBXSJGVUDC-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.27 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|