C11H18O4S — CID 57367048
1-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)ethanesulfonic acid (PubChem CID 57367048) has the molecular formula C11H18O4S and a molecular weight of 246.33 g/mol. Its IUPAC name is 1-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)ethanesulfonic acid.
| Compound Name | 1-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)ethanesulfonic acid |
|---|---|
| PubChem CID | 57367048 |
| Molecular Formula | C11H18O4S |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 1-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)ethanesulfonic acid |
| SMILES | CC(C12CCC(CC1=O)C2(C)C)S(=O)(=O)O |
| InChI | InChI=1S/C11H18O4S/c1-7(16(13,14)15)11-5-4-8(6-9(11)12)10(11,2)3/h7-8H,4-6H2,1-3H3,(H,13,14,15) |
| InChIKey | AXNSPDFKBZLBIJ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|