C16H19IO4S — CID 175281567
phenyl (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)-iodomethanesulfonate (PubChem CID 175281567) has the molecular formula C16H19IO4S and a molecular weight of 434.30 g/mol. Its IUPAC name is phenyl (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)-iodomethanesulfonate.
| Compound Name | phenyl (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)-iodomethanesulfonate |
|---|---|
| PubChem CID | 175281567 |
| Molecular Formula | C16H19IO4S |
| Molecular Weight | 434.30 g/mol |
| Exact Mass | 434.00 |
| IUPAC Name | phenyl (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)-iodomethanesulfonate |
| SMILES | CC1(C)C2CCC1(C(I)S(=O)(=O)Oc1ccccc1)C(=O)C2 |
| InChI | InChI=1S/C16H19IO4S/c1-15(2)11-8-9-16(15,13(18)10-11)14(17)22(19,20)21-12-6-4-3-5-7-12/h3-7,11,14H,8-10H2,1-2H3 |
| InChIKey | CRMPYXYGBHOELT-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.30 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|