About (2-oxocyclohexyl) (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)-sulfanylmethanesulfonate
(2-oxocyclohexyl) (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)-sulfanylmethanesulfonate (PubChem CID 174480203) has the molecular formula C16H24O5S2
and a molecular weight of 360.50 g/mol. Its IUPAC name is (2-oxocyclohexyl) (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)-sulfanylmethanesulfonate.
Molecular Properties
| Compound Name | (2-oxocyclohexyl) (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)-sulfanylmethanesulfonate |
| PubChem CID | 174480203 |
| Molecular Formula | C16H24O5S2 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | (2-oxocyclohexyl) (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)-sulfanylmethanesulfonate |
| SMILES | CC1(C)C2CCC1(C(S)S(=O)(=O)OC1CCCCC1=O)C(=O)C2 |
| InChI | InChI=1S/C16H24O5S2/c1-15(2)10-7-8-16(15,13(18)9-10)14(22)23(19,20)21-12-6-4-3-5-11(12)17/h10,12,14,22H,3-9H2,1-2H3 |
| InChIKey | RMHIGZSDTPSNHV-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 77.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (2-oxocyclohexyl) (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)-sulfanylmethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxocyclohexyl) (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)-sulfanylmethanesulfonate?
The IUPAC name of (2-oxocyclohexyl) (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)-sulfanylmethanesulfonate (CID 174480203) is (2-oxocyclohexyl) (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)-sulfanylmethanesulfonate.
What is the SMILES notation for (2-oxocyclohexyl) (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)-sulfanylmethanesulfonate?
The canonical SMILES for (2-oxocyclohexyl) (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)-sulfanylmethanesulfonate is CC1(C)C2CCC1(C(S)S(=O)(=O)OC1CCCCC1=O)C(=O)C2.
What is the InChIKey of (2-oxocyclohexyl) (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)-sulfanylmethanesulfonate?
The InChIKey is RMHIGZSDTPSNHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24O5S2/c1-15(2)10-7-8-16(15,13(18)9-10)14(22)23(19,20)21-12-6-4-3-5-11(12)17/h10,12,14,22H,3-9H2,1-2H3.
What are the key properties of (2-oxocyclohexyl) (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)-sulfanylmethanesulfonate?
(2-oxocyclohexyl) (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)-sulfanylmethanesulfonate has a molecular weight of 360.50 g/mol, XLogP of 2.50, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxocyclohexyl) (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)-sulfanylmethanesulfonate is sourced from PubChem (CID 174480203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).