C16H24O5S2 — CID 174480203
(2-oxocyclohexyl) (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)-sulfanylmethanesulfonate (PubChem CID 174480203) has the molecular formula C16H24O5S2 and a molecular weight of 360.50 g/mol. Its IUPAC name is (2-oxocyclohexyl) (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)-sulfanylmethanesulfonate.
| Compound Name | (2-oxocyclohexyl) (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)-sulfanylmethanesulfonate |
|---|---|
| PubChem CID | 174480203 |
| Molecular Formula | C16H24O5S2 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | (2-oxocyclohexyl) (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)-sulfanylmethanesulfonate |
| SMILES | CC1(C)C2CCC1(C(S)S(=O)(=O)OC1CCCCC1=O)C(=O)C2 |
| InChI | InChI=1S/C16H24O5S2/c1-15(2)10-7-8-16(15,13(18)9-10)14(22)23(19,20)21-12-6-4-3-5-11(12)17/h10,12,14,22H,3-9H2,1-2H3 |
| InChIKey | RMHIGZSDTPSNHV-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 77.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|