C10H16O4S — CID 170157458
[(1R,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl] methanesulfonate (PubChem CID 170157458) has the molecular formula C10H16O4S and a molecular weight of 232.30 g/mol. Its IUPAC name is [(1R,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl] methanesulfonate.
| Compound Name | [(1R,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl] methanesulfonate |
|---|---|
| PubChem CID | 170157458 |
| Molecular Formula | C10H16O4S |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | [(1R,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl] methanesulfonate |
| SMILES | CC1(C)[C@@H]2CC[C@]1(OS(C)(=O)=O)C(=O)C2 |
| InChI | InChI=1S/C10H16O4S/c1-9(2)7-4-5-10(9,8(11)6-7)14-15(3,12)13/h7H,4-6H2,1-3H3/t7-,10+/m1/s1 |
| InChIKey | WCIWAEVXQSYRML-XCBNKYQSSA-N |
| XLogP | 1.11 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|