C10H18OS — CID 174955464
sulfane;1,7,7-trimethylbicyclo[2.2.1]heptan-2-one (PubChem CID 174955464) has the molecular formula C10H18OS and a molecular weight of 184.24 g/mol. Its IUPAC name is sulfane;1,7,7-trimethylbicyclo[2.2.1]heptan-2-one.
| Compound Name | sulfane;1,7,7-trimethylbicyclo[2.2.1]heptan-2-one |
|---|---|
| PubChem CID | 174955464 |
| Molecular Formula | C10H18OS |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | sulfane;1,7,7-trimethylbicyclo[2.2.1]heptan-2-one |
| SMILES | CC12CCC(CC1=O)C2(C)C.[30SH2] |
| InChI | InChI=1S/C10H16O.H2S/c1-9(2)7-4-5-10(9,3)8(11)6-7;/h7H,4-6H2,1-3H3;1H2/i;1-2 |
| InChIKey | QFASPCGPLVFDCI-ZQSXMSGHSA-N |
| XLogP | 2.51 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |