C30H52N2O2 — CID 159556446
1,8,8-trimethyl-2-azabicyclo[3.2.1]octane;1,8,8-trimethyl-2-azabicyclo[3.2.1]octan-3-one;1,7,7-trimethylbicyclo[2.2.1]heptan-2-one (PubChem CID 159556446) has the molecular formula C30H52N2O2 and a molecular weight of 472.76 g/mol. Its IUPAC name is 1,8,8-trimethyl-2-azabicyclo[3.2.1]octane;1,8,8-trimethyl-2-azabicyclo[3.2.1]octan-3-one;1,7,7-trimethylbicyclo[2.2.1]heptan-2-one.
| Compound Name | 1,8,8-trimethyl-2-azabicyclo[3.2.1]octane;1,8,8-trimethyl-2-azabicyclo[3.2.1]octan-3-one;1,7,7-trimethylbicyclo[2.2.1]heptan-2-one |
|---|---|
| PubChem CID | 159556446 |
| Molecular Formula | C30H52N2O2 |
| Molecular Weight | 472.76 g/mol |
| Exact Mass | 472.40 |
| IUPAC Name | 1,8,8-trimethyl-2-azabicyclo[3.2.1]octane;1,8,8-trimethyl-2-azabicyclo[3.2.1]octan-3-one;1,7,7-trimethylbicyclo[2.2.1]heptan-2-one |
| SMILES | CC12CCC(CC(=O)N1)C2(C)C.CC12CCC(CC1=O)C2(C)C.CC12CCC(CCN1)C2(C)C |
| InChI | InChI=1S/C10H17NO.C10H19N.C10H16O/c1-9(2)7-4-5-10(9,3)11-8(12)6-7;1-9(2)8-4-6-10(9,3)11-7-5-8;1-9(2)7-4-5-10(9,3)8(11)6-7/h7H,4-6H2,1-3H3,(H,11,12);8,11H,4-7H2,1-3H3;7H,4-6H2,1-3H3 |
| InChIKey | MGAXSHCLQFBJPK-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.76 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |