C16H24O2Se — CID 172999582
phenol;selane;1,7,7-trimethylbicyclo[2.2.1]heptan-2-one (PubChem CID 172999582) has the molecular formula C16H24O2Se and a molecular weight of 327.33 g/mol. Its IUPAC name is phenol;selane;1,7,7-trimethylbicyclo[2.2.1]heptan-2-one.
| Compound Name | phenol;selane;1,7,7-trimethylbicyclo[2.2.1]heptan-2-one |
|---|---|
| PubChem CID | 172999582 |
| Molecular Formula | C16H24O2Se |
| Molecular Weight | 327.33 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | phenol;selane;1,7,7-trimethylbicyclo[2.2.1]heptan-2-one |
| SMILES | CC12CCC(CC1=O)C2(C)C.Oc1ccccc1.[SeH2] |
| InChI | InChI=1S/C10H16O.C6H6O.H2Se/c1-9(2)7-4-5-10(9,3)8(11)6-7;7-6-4-2-1-3-5-6;/h7H,4-6H2,1-3H3;1-5,7H;1H2 |
| InChIKey | FJFVVGZFWACKLV-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.33 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|