About phenol;selane;1,7,7-trimethylbicyclo[2.2.1]heptan-2-one
phenol;selane;1,7,7-trimethylbicyclo[2.2.1]heptan-2-one (PubChem CID 172999582) has the molecular formula C16H24O2Se
and a molecular weight of 327.33 g/mol. Its IUPAC name is phenol;selane;1,7,7-trimethylbicyclo[2.2.1]heptan-2-one.
Molecular Properties
| Compound Name | phenol;selane;1,7,7-trimethylbicyclo[2.2.1]heptan-2-one |
| PubChem CID | 172999582 |
| Molecular Formula | C16H24O2Se |
| Molecular Weight | 327.33 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | phenol;selane;1,7,7-trimethylbicyclo[2.2.1]heptan-2-one |
| SMILES | CC12CCC(CC1=O)C2(C)C.Oc1ccccc1.[SeH2] |
| InChI | InChI=1S/C10H16O.C6H6O.H2Se/c1-9(2)7-4-5-10(9,3)8(11)6-7;7-6-4-2-1-3-5-6;/h7H,4-6H2,1-3H3;1-5,7H;1H2 |
| InChIKey | FJFVVGZFWACKLV-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.33 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze phenol;selane;1,7,7-trimethylbicyclo[2.2.1]heptan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenol;selane;1,7,7-trimethylbicyclo[2.2.1]heptan-2-one?
The IUPAC name of phenol;selane;1,7,7-trimethylbicyclo[2.2.1]heptan-2-one (CID 172999582) is phenol;selane;1,7,7-trimethylbicyclo[2.2.1]heptan-2-one.
What is the SMILES notation for phenol;selane;1,7,7-trimethylbicyclo[2.2.1]heptan-2-one?
The canonical SMILES for phenol;selane;1,7,7-trimethylbicyclo[2.2.1]heptan-2-one is CC12CCC(CC1=O)C2(C)C.Oc1ccccc1.[SeH2].
What is the InChIKey of phenol;selane;1,7,7-trimethylbicyclo[2.2.1]heptan-2-one?
The InChIKey is FJFVVGZFWACKLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O.C6H6O.H2Se/c1-9(2)7-4-5-10(9,3)8(11)6-7;7-6-4-2-1-3-5-6;/h7H,4-6H2,1-3H3;1-5,7H;1H2.
What are the key properties of phenol;selane;1,7,7-trimethylbicyclo[2.2.1]heptan-2-one?
phenol;selane;1,7,7-trimethylbicyclo[2.2.1]heptan-2-one has a molecular weight of 327.33 g/mol, XLogP of 2.88, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phenol;selane;1,7,7-trimethylbicyclo[2.2.1]heptan-2-one is sourced from PubChem (CID 172999582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).