C27H36O2 — CID 157212081
3-benzylidene-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one;1,7,7-trimethylbicyclo[2.2.1]heptan-2-one (PubChem CID 157212081) has the molecular formula C27H36O2 and a molecular weight of 392.58 g/mol. Its IUPAC name is 3-benzylidene-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one;1,7,7-trimethylbicyclo[2.2.1]heptan-2-one.
| Compound Name | 3-benzylidene-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one;1,7,7-trimethylbicyclo[2.2.1]heptan-2-one |
|---|---|
| PubChem CID | 157212081 |
| Molecular Formula | C27H36O2 |
| Molecular Weight | 392.58 g/mol |
| Exact Mass | 392.27 |
| IUPAC Name | 3-benzylidene-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one;1,7,7-trimethylbicyclo[2.2.1]heptan-2-one |
| SMILES | CC12CCC(C(=Cc3ccccc3)C1=O)C2(C)C.CC12CCC(CC1=O)C2(C)C |
| InChI | InChI=1S/C17H20O.C10H16O/c1-16(2)14-9-10-17(16,3)15(18)13(14)11-12-7-5-4-6-8-12;1-9(2)7-4-5-10(9,3)8(11)6-7/h4-8,11,14H,9-10H2,1-3H3;7H,4-6H2,1-3H3 |
| InChIKey | ARZSXDUNZYFCSC-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.58 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|