C17H19IO — CID 141072219
(3E)-3-[(3-iodophenyl)methylidene]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one (PubChem CID 141072219) has the molecular formula C17H19IO and a molecular weight of 366.24 g/mol. Its IUPAC name is (3E)-3-[(3-iodophenyl)methylidene]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one.
| Compound Name | (3E)-3-[(3-iodophenyl)methylidene]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one |
|---|---|
| PubChem CID | 141072219 |
| Molecular Formula | C17H19IO |
| Molecular Weight | 366.24 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | (3E)-3-[(3-iodophenyl)methylidene]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one |
| SMILES | CC12CCC(/C(=C\c3cccc(I)c3)C1=O)C2(C)C |
| InChI | InChI=1S/C17H19IO/c1-16(2)14-7-8-17(16,3)15(19)13(14)10-11-5-4-6-12(18)9-11/h4-6,9-10,14H,7-8H2,1-3H3/b13-10+ |
| InChIKey | CGZAXTVRNRSPGK-JLHYYAGUSA-N |
| XLogP | 4.70 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.24 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|