C21H30NO+ — CID 98048578
trimethyl-[2-methyl-4-[(Z)-[(1R,4R)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene]methyl]phenyl]azanium (PubChem CID 98048578) has the molecular formula C21H30NO+ and a molecular weight of 312.48 g/mol. Its IUPAC name is trimethyl-[2-methyl-4-[(Z)-[(1R,4R)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene]methyl]phenyl]azanium.
| Compound Name | trimethyl-[2-methyl-4-[(Z)-[(1R,4R)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene]methyl]phenyl]azanium |
|---|---|
| PubChem CID | 98048578 |
| Molecular Formula | C21H30NO+ |
| Molecular Weight | 312.48 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | trimethyl-[2-methyl-4-[(Z)-[(1R,4R)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene]methyl]phenyl]azanium |
| SMILES | Cc1cc(/C=C2\C(=O)[C@]3(C)CC[C@@H]2C3(C)C)ccc1[N+](C)(C)C |
| InChI | InChI=1S/C21H30NO/c1-14-12-15(8-9-18(14)22(5,6)7)13-16-17-10-11-21(4,19(16)23)20(17,2)3/h8-9,12-13,17H,10-11H2,1-7H3/q+1/b16-13-/t17-,21-/m0/s1 |
| InChIKey | PIQZAZWTLJXHDL-CBXNBBCMSA-N |
| XLogP | 4.60 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.48 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|