C20H28NO+ — CID 50935404
trimethyl-[4-[(Z)-[(1R,4R)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene]methyl]phenyl]azanium (PubChem CID 50935404) has the molecular formula C20H28NO+ and a molecular weight of 298.45 g/mol. Its IUPAC name is trimethyl-[4-[(Z)-[(1R,4R)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene]methyl]phenyl]azanium.
| Compound Name | trimethyl-[4-[(Z)-[(1R,4R)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene]methyl]phenyl]azanium |
|---|---|
| PubChem CID | 50935404 |
| Molecular Formula | C20H28NO+ |
| Molecular Weight | 298.45 g/mol |
| Exact Mass | 298.22 |
| IUPAC Name | trimethyl-[4-[(Z)-[(1R,4R)-4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene]methyl]phenyl]azanium |
| SMILES | CC1(C)[C@H]2CC[C@@]1(C)C(=O)/C2=C\c1ccc([N+](C)(C)C)cc1 |
| InChI | InChI=1S/C20H28NO/c1-19(2)17-11-12-20(19,3)18(22)16(17)13-14-7-9-15(10-8-14)21(4,5)6/h7-10,13,17H,11-12H2,1-6H3/q+1/b16-13-/t17-,20-/m0/s1 |
| InChIKey | QGISLNJSJIGSLZ-WTLFXYFDSA-N |
| XLogP | 4.29 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.45 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|