C21H30NO+ — CID 87399586
trimethyl-[4-[2-(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene)ethyl]phenyl]azanium (PubChem CID 87399586) has the molecular formula C21H30NO+ and a molecular weight of 312.48 g/mol. Its IUPAC name is trimethyl-[4-[2-(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene)ethyl]phenyl]azanium.
| Compound Name | trimethyl-[4-[2-(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene)ethyl]phenyl]azanium |
|---|---|
| PubChem CID | 87399586 |
| Molecular Formula | C21H30NO+ |
| Molecular Weight | 312.48 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | trimethyl-[4-[2-(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene)ethyl]phenyl]azanium |
| SMILES | CC12CCC(C(=CCc3ccc([N+](C)(C)C)cc3)C1=O)C2(C)C |
| InChI | InChI=1S/C21H30NO/c1-20(2)18-13-14-21(20,3)19(23)17(18)12-9-15-7-10-16(11-8-15)22(4,5)6/h7-8,10-12,18H,9,13-14H2,1-6H3/q+1 |
| InChIKey | CEQRXBVUURSFKB-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.48 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|