C20H24O4S — CID 160554902
naphthalene-1-sulfonic acid;1,7,7-trimethylbicyclo[2.2.1]heptan-2-one (PubChem CID 160554902) has the molecular formula C20H24O4S and a molecular weight of 360.48 g/mol. Its IUPAC name is naphthalene-1-sulfonic acid;1,7,7-trimethylbicyclo[2.2.1]heptan-2-one.
| Compound Name | naphthalene-1-sulfonic acid;1,7,7-trimethylbicyclo[2.2.1]heptan-2-one |
|---|---|
| PubChem CID | 160554902 |
| Molecular Formula | C20H24O4S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | naphthalene-1-sulfonic acid;1,7,7-trimethylbicyclo[2.2.1]heptan-2-one |
| SMILES | CC12CCC(CC1=O)C2(C)C.O=S(=O)(O)c1cccc2ccccc12 |
| InChI | InChI=1S/C10H8O3S.C10H16O/c11-14(12,13)10-7-3-5-8-4-1-2-6-9(8)10;1-9(2)7-4-5-10(9,3)8(11)6-7/h1-7H,(H,11,12,13);7H,4-6H2,1-3H3 |
| InChIKey | QYNYELLQSKHQMG-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|